C10H14N2 — CID 123586881
2,4-dimethyl-1,2,6,7-tetrahydro-1,8-naphthyridine (PubChem CID 123586881) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2,4-dimethyl-1,2,6,7-tetrahydro-1,8-naphthyridine.
| Compound Name | 2,4-dimethyl-1,2,6,7-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 123586881 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2,4-dimethyl-1,2,6,7-tetrahydro-1,8-naphthyridine |
| SMILES | CC1=CC(C)NC2=NCCC=C12 |
| InChI | InChI=1S/C10H14N2/c1-7-6-8(2)12-10-9(7)4-3-5-11-10/h4,6,8H,3,5H2,1-2H3,(H,11,12) |
| InChIKey | YGEFDUPJRJYRTL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |