C11H18N2 — CID 136646954
3,6-diethyl-N-methyl-1,2-dihydroazepin-7-imine (PubChem CID 136646954) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 3,6-diethyl-N-methyl-1,2-dihydroazepin-7-imine.
| Compound Name | 3,6-diethyl-N-methyl-1,2-dihydroazepin-7-imine |
|---|---|
| PubChem CID | 136646954 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 3,6-diethyl-N-methyl-1,2-dihydroazepin-7-imine |
| SMILES | CCC1=CC=C(CC)/C(=N/C)NC1 |
| InChI | InChI=1S/C11H18N2/c1-4-9-6-7-10(5-2)11(12-3)13-8-9/h6-7H,4-5,8H2,1-3H3,(H,12,13) |
| InChIKey | UGEUOMIGOIEWHT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|