C14H25N3 — CID 123507286
N-(4-aminocyclohexyl)-N'-methyl-2-methylidenehex-3-enimidamide (PubChem CID 123507286) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-N'-methyl-2-methylidenehex-3-enimidamide.
| Compound Name | N-(4-aminocyclohexyl)-N'-methyl-2-methylidenehex-3-enimidamide |
|---|---|
| PubChem CID | 123507286 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N-(4-aminocyclohexyl)-N'-methyl-2-methylidenehex-3-enimidamide |
| SMILES | C=C(C=CCC)/C(=N\C)NC1CCC(N)CC1 |
| InChI | InChI=1S/C14H25N3/c1-4-5-6-11(2)14(16-3)17-13-9-7-12(15)8-10-13/h5-6,12-13H,2,4,7-10,15H2,1,3H3,(H,16,17) |
| InChIKey | UAOTYLFGAJPWJV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|