C12H22N2 — CID 143201854
(3Z)-N-methyl-3-prop-2-enylidenepiperidin-2-imine;propane (PubChem CID 143201854) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (3Z)-N-methyl-3-prop-2-enylidenepiperidin-2-imine;propane.
| Compound Name | (3Z)-N-methyl-3-prop-2-enylidenepiperidin-2-imine;propane |
|---|---|
| PubChem CID | 143201854 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (3Z)-N-methyl-3-prop-2-enylidenepiperidin-2-imine;propane |
| SMILES | C=C/C=C1/CCCN/C1=N\C.CCC |
| InChI | InChI=1S/C9H14N2.C3H8/c1-3-5-8-6-4-7-11-9(8)10-2;1-3-2/h3,5H,1,4,6-7H2,2H3,(H,10,11);3H2,1-2H3/b8-5-; |
| InChIKey | OSLOCVBHYNVFKO-HGKIGUAWSA-N |
| XLogP | 2.93 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|