C12H23ClN2 — CID 167491687
(2Z,4E)-4-chloro-N-ethyl-N'-methylhepta-2,4-dienimidamide;ethane (PubChem CID 167491687) has the molecular formula C12H23ClN2 and a molecular weight of 230.78 g/mol. Its IUPAC name is (2Z,4E)-4-chloro-N-ethyl-N'-methylhepta-2,4-dienimidamide;ethane.
| Compound Name | (2Z,4E)-4-chloro-N-ethyl-N'-methylhepta-2,4-dienimidamide;ethane |
|---|---|
| PubChem CID | 167491687 |
| Molecular Formula | C12H23ClN2 |
| Molecular Weight | 230.78 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (2Z,4E)-4-chloro-N-ethyl-N'-methylhepta-2,4-dienimidamide;ethane |
| SMILES | CC.CC/C=C(Cl)\C=C/C(=N/C)NCC |
| InChI | InChI=1S/C10H17ClN2.C2H6/c1-4-6-9(11)7-8-10(12-3)13-5-2;1-2/h6-8H,4-5H2,1-3H3,(H,12,13);1-2H3/b8-7-,9-6+; |
| InChIKey | QRPCDXIGHMBDNF-DAHMJHCMSA-N |
| XLogP | 3.74 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.78 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|