About (E)-N-but-3-enyl-N'-methylbut-2-enimidamide
(E)-N-but-3-enyl-N'-methylbut-2-enimidamide (PubChem CID 145174398) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is (E)-N-but-3-enyl-N'-methylbut-2-enimidamide.
Molecular Properties
| Compound Name | (E)-N-but-3-enyl-N'-methylbut-2-enimidamide |
| PubChem CID | 145174398 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (E)-N-but-3-enyl-N'-methylbut-2-enimidamide |
| SMILES | C=CCCNC(/C=C/C)=N/C |
| InChI | InChI=1S/C9H16N2/c1-4-6-8-11-9(10-3)7-5-2/h4-5,7H,1,6,8H2,2-3H3,(H,10,11)/b7-5+ |
| InChIKey | YGZXAWQCIQZDSH-FNORWQNLSA-N |
| XLogP | 1.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-but-3-enyl-N'-methylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-but-3-enyl-N'-methylbut-2-enimidamide?
The IUPAC name of (E)-N-but-3-enyl-N'-methylbut-2-enimidamide (CID 145174398) is (E)-N-but-3-enyl-N'-methylbut-2-enimidamide.
What is the SMILES notation for (E)-N-but-3-enyl-N'-methylbut-2-enimidamide?
The canonical SMILES for (E)-N-but-3-enyl-N'-methylbut-2-enimidamide is C=CCCNC(/C=C/C)=N/C.
What is the InChIKey of (E)-N-but-3-enyl-N'-methylbut-2-enimidamide?
The InChIKey is YGZXAWQCIQZDSH-FNORWQNLSA-N. The full InChI is InChI=1S/C9H16N2/c1-4-6-8-11-9(10-3)7-5-2/h4-5,7H,1,6,8H2,2-3H3,(H,10,11)/b7-5+.
What are the key properties of (E)-N-but-3-enyl-N'-methylbut-2-enimidamide?
(E)-N-but-3-enyl-N'-methylbut-2-enimidamide has a molecular weight of 152.24 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-but-3-enyl-N'-methylbut-2-enimidamide is sourced from PubChem (CID 145174398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).