C6H9FN2 — CID 163981498
3-fluoro-N-methyl-2,3-dihydro-1H-pyridin-6-imine (PubChem CID 163981498) has the molecular formula C6H9FN2 and a molecular weight of 128.15 g/mol. Its IUPAC name is 3-fluoro-N-methyl-2,3-dihydro-1H-pyridin-6-imine.
| Compound Name | 3-fluoro-N-methyl-2,3-dihydro-1H-pyridin-6-imine |
|---|---|
| PubChem CID | 163981498 |
| Molecular Formula | C6H9FN2 |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 3-fluoro-N-methyl-2,3-dihydro-1H-pyridin-6-imine |
| SMILES | C/N=C1\C=CC(F)CN1 |
| InChI | InChI=1S/C6H9FN2/c1-8-6-3-2-5(7)4-9-6/h2-3,5H,4H2,1H3,(H,8,9) |
| InChIKey | SYUJRXHXHFVMJO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|