C10H17ClN2 — CID 167491688
(2Z,4E)-4-chloro-N-ethyl-N'-methylhepta-2,4-dienimidamide (PubChem CID 167491688) has the molecular formula C10H17ClN2 and a molecular weight of 200.71 g/mol. Its IUPAC name is (2Z,4E)-4-chloro-N-ethyl-N'-methylhepta-2,4-dienimidamide.
| Compound Name | (2Z,4E)-4-chloro-N-ethyl-N'-methylhepta-2,4-dienimidamide |
|---|---|
| PubChem CID | 167491688 |
| Molecular Formula | C10H17ClN2 |
| Molecular Weight | 200.71 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | (2Z,4E)-4-chloro-N-ethyl-N'-methylhepta-2,4-dienimidamide |
| SMILES | CC/C=C(Cl)\C=C/C(=N/C)NCC |
| InChI | InChI=1S/C10H17ClN2/c1-4-6-9(11)7-8-10(12-3)13-5-2/h6-8H,4-5H2,1-3H3,(H,12,13)/b8-7-,9-6+ |
| InChIKey | HOZVILIDJQFXNS-SOKJVCRVSA-N |
| XLogP | 2.71 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.71 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|