About ethanamine;(Z)-N-ethyl-N'-methylpent-2-enimidamide
ethanamine;(Z)-N-ethyl-N'-methylpent-2-enimidamide (PubChem CID 143576284) has the molecular formula C10H23N3
and a molecular weight of 185.31 g/mol. Its IUPAC name is ethanamine;(Z)-N-ethyl-N'-methylpent-2-enimidamide.
Molecular Properties
| Compound Name | ethanamine;(Z)-N-ethyl-N'-methylpent-2-enimidamide |
| PubChem CID | 143576284 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | ethanamine;(Z)-N-ethyl-N'-methylpent-2-enimidamide |
| SMILES | CC/C=C\C(=N\C)NCC.CCN |
| InChI | InChI=1S/C8H16N2.C2H7N/c1-4-6-7-8(9-3)10-5-2;1-2-3/h6-7H,4-5H2,1-3H3,(H,9,10);2-3H2,1H3/b7-6-; |
| InChIKey | OBMGSSFBHKJZOE-NAFXZHHSSA-N |
| XLogP | 1.56 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;(Z)-N-ethyl-N'-methylpent-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;(Z)-N-ethyl-N'-methylpent-2-enimidamide?
The IUPAC name of ethanamine;(Z)-N-ethyl-N'-methylpent-2-enimidamide (CID 143576284) is ethanamine;(Z)-N-ethyl-N'-methylpent-2-enimidamide.
What is the SMILES notation for ethanamine;(Z)-N-ethyl-N'-methylpent-2-enimidamide?
The canonical SMILES for ethanamine;(Z)-N-ethyl-N'-methylpent-2-enimidamide is CC/C=C\C(=N\C)NCC.CCN.
What is the InChIKey of ethanamine;(Z)-N-ethyl-N'-methylpent-2-enimidamide?
The InChIKey is OBMGSSFBHKJZOE-NAFXZHHSSA-N. The full InChI is InChI=1S/C8H16N2.C2H7N/c1-4-6-7-8(9-3)10-5-2;1-2-3/h6-7H,4-5H2,1-3H3,(H,9,10);2-3H2,1H3/b7-6-;.
What are the key properties of ethanamine;(Z)-N-ethyl-N'-methylpent-2-enimidamide?
ethanamine;(Z)-N-ethyl-N'-methylpent-2-enimidamide has a molecular weight of 185.31 g/mol, XLogP of 1.56, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;(Z)-N-ethyl-N'-methylpent-2-enimidamide is sourced from PubChem (CID 143576284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).