C21H31N3 — CID 142814888
ethane;(5E,6E)-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5,6-bis(prop-2-enylidene)pyrimidin-4-amine (PubChem CID 142814888) has the molecular formula C21H31N3 and a molecular weight of 325.50 g/mol. Its IUPAC name is ethane;(5E,6E)-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5,6-bis(prop-2-enylidene)pyrimidin-4-amine.
| Compound Name | ethane;(5E,6E)-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5,6-bis(prop-2-enylidene)pyrimidin-4-amine |
|---|---|
| PubChem CID | 142814888 |
| Molecular Formula | C21H31N3 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | ethane;(5E,6E)-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5,6-bis(prop-2-enylidene)pyrimidin-4-amine |
| SMILES | C=C/C=C\C(=C/C)Nc1ncnc(=C/C=C)/c1=C\C=C.CC.CC |
| InChI | InChI=1S/C17H19N3.2C2H6/c1-5-9-12-14(8-4)20-17-15(10-6-2)16(11-7-3)18-13-19-17;2*1-2/h5-13H,1-3H2,4H3,(H,18,19,20);2*1-2H3/b12-9-,14-8+,15-10+,16-11+;; |
| InChIKey | ZCJXHYSOLASSOU-VNDGLMPWSA-N |
| XLogP | 4.52 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|