C12H20N2 — CID 143712976
N,6-diethyl-2H-azepin-7-amine;ethene (PubChem CID 143712976) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N,6-diethyl-2H-azepin-7-amine;ethene.
| Compound Name | N,6-diethyl-2H-azepin-7-amine;ethene |
|---|---|
| PubChem CID | 143712976 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N,6-diethyl-2H-azepin-7-amine;ethene |
| SMILES | C=C.CCNC1=NCC=CC=C1CC |
| InChI | InChI=1S/C10H16N2.C2H4/c1-3-9-7-5-6-8-12-10(9)11-4-2;1-2/h5-7H,3-4,8H2,1-2H3,(H,11,12);1-2H2 |
| InChIKey | ZXFIOFBJAJDKHQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|