C9H14N2 — CID 137072858
2-ethyl-N-methyl-1,2-dihydroazepin-7-imine (PubChem CID 137072858) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-ethyl-N-methyl-1,2-dihydroazepin-7-imine.
| Compound Name | 2-ethyl-N-methyl-1,2-dihydroazepin-7-imine |
|---|---|
| PubChem CID | 137072858 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-ethyl-N-methyl-1,2-dihydroazepin-7-imine |
| SMILES | CCC1C=CC=C/C(=N\C)N1 |
| InChI | InChI=1S/C9H14N2/c1-3-8-6-4-5-7-9(10-2)11-8/h4-8H,3H2,1-2H3,(H,10,11) |
| InChIKey | NFBHPCQZVNXTNS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|