About (Z)-N-ethyl-2-imino-N'-methylpent-3-enimidamide
(Z)-N-ethyl-2-imino-N'-methylpent-3-enimidamide (PubChem CID 123967106) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is (Z)-N-ethyl-2-imino-N'-methylpent-3-enimidamide.
Molecular Properties
| Compound Name | (Z)-N-ethyl-2-imino-N'-methylpent-3-enimidamide |
| PubChem CID | 123967106 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | (Z)-N-ethyl-2-imino-N'-methylpent-3-enimidamide |
| SMILES | [H]/N=C(\C=C/C)C(=N/C)/NCC |
| InChI | InChI=1S/C8H15N3/c1-4-6-7(9)8(10-3)11-5-2/h4,6,9H,5H2,1-3H3,(H,10,11)/b6-4-,9-7+ |
| InChIKey | OKMBZASFVYLRNG-UNQQQNFISA-N |
| XLogP | 1.22 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-ethyl-2-imino-N'-methylpent-3-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-ethyl-2-imino-N'-methylpent-3-enimidamide?
The IUPAC name of (Z)-N-ethyl-2-imino-N'-methylpent-3-enimidamide (CID 123967106) is (Z)-N-ethyl-2-imino-N'-methylpent-3-enimidamide.
What is the SMILES notation for (Z)-N-ethyl-2-imino-N'-methylpent-3-enimidamide?
The canonical SMILES for (Z)-N-ethyl-2-imino-N'-methylpent-3-enimidamide is [H]/N=C(\C=C/C)C(=N/C)/NCC.
What is the InChIKey of (Z)-N-ethyl-2-imino-N'-methylpent-3-enimidamide?
The InChIKey is OKMBZASFVYLRNG-UNQQQNFISA-N. The full InChI is InChI=1S/C8H15N3/c1-4-6-7(9)8(10-3)11-5-2/h4,6,9H,5H2,1-3H3,(H,10,11)/b6-4-,9-7+.
What are the key properties of (Z)-N-ethyl-2-imino-N'-methylpent-3-enimidamide?
(Z)-N-ethyl-2-imino-N'-methylpent-3-enimidamide has a molecular weight of 153.23 g/mol, XLogP of 1.22, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-ethyl-2-imino-N'-methylpent-3-enimidamide is sourced from PubChem (CID 123967106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).