About (Z)-N,N'-dimethyl-2,3-bis(methylimino)hex-4-enimidamide
(Z)-N,N'-dimethyl-2,3-bis(methylimino)hex-4-enimidamide (PubChem CID 90826663) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is (Z)-N,N'-dimethyl-2,3-bis(methylimino)hex-4-enimidamide.
Molecular Properties
| Compound Name | (Z)-N,N'-dimethyl-2,3-bis(methylimino)hex-4-enimidamide |
| PubChem CID | 90826663 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (Z)-N,N'-dimethyl-2,3-bis(methylimino)hex-4-enimidamide |
| SMILES | C/C=C\C(=N/C)C(=N\C)\C(=N\C)NC |
| InChI | InChI=1S/C10H18N4/c1-6-7-8(11-2)9(12-3)10(13-4)14-5/h6-7H,1-5H3,(H,13,14)/b7-6-,11-8+,12-9- |
| InChIKey | GLVJKCUUBGKVSI-SVYHAQGUSA-N |
| XLogP | 0.95 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,N'-dimethyl-2,3-bis(methylimino)hex-4-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,N'-dimethyl-2,3-bis(methylimino)hex-4-enimidamide?
The IUPAC name of (Z)-N,N'-dimethyl-2,3-bis(methylimino)hex-4-enimidamide (CID 90826663) is (Z)-N,N'-dimethyl-2,3-bis(methylimino)hex-4-enimidamide.
What is the SMILES notation for (Z)-N,N'-dimethyl-2,3-bis(methylimino)hex-4-enimidamide?
The canonical SMILES for (Z)-N,N'-dimethyl-2,3-bis(methylimino)hex-4-enimidamide is C/C=C\C(=N/C)C(=N\C)\C(=N\C)NC.
What is the InChIKey of (Z)-N,N'-dimethyl-2,3-bis(methylimino)hex-4-enimidamide?
The InChIKey is GLVJKCUUBGKVSI-SVYHAQGUSA-N. The full InChI is InChI=1S/C10H18N4/c1-6-7-8(11-2)9(12-3)10(13-4)14-5/h6-7H,1-5H3,(H,13,14)/b7-6-,11-8+,12-9-.
What are the key properties of (Z)-N,N'-dimethyl-2,3-bis(methylimino)hex-4-enimidamide?
(Z)-N,N'-dimethyl-2,3-bis(methylimino)hex-4-enimidamide has a molecular weight of 194.28 g/mol, XLogP of 0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,N'-dimethyl-2,3-bis(methylimino)hex-4-enimidamide is sourced from PubChem (CID 90826663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).