C11H18N2 — CID 123274400
N-cyclohepta-2,4-dien-1-yl-N'-methylpropanimidamide (PubChem CID 123274400) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N-cyclohepta-2,4-dien-1-yl-N'-methylpropanimidamide.
| Compound Name | N-cyclohepta-2,4-dien-1-yl-N'-methylpropanimidamide |
|---|---|
| PubChem CID | 123274400 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N-cyclohepta-2,4-dien-1-yl-N'-methylpropanimidamide |
| SMILES | CC/C(=N\C)NC1C=CC=CCC1 |
| InChI | InChI=1S/C11H18N2/c1-3-11(12-2)13-10-8-6-4-5-7-9-10/h4-6,8,10H,3,7,9H2,1-2H3,(H,12,13) |
| InChIKey | DPAJZEYPCWYMQI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|