C12H19N3 — CID 90969650
9-methyl-2-pyrrolidin-2-yl-4,9-dihydro-1H-1,3-diazonine (PubChem CID 90969650) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 9-methyl-2-pyrrolidin-2-yl-4,9-dihydro-1H-1,3-diazonine.
| Compound Name | 9-methyl-2-pyrrolidin-2-yl-4,9-dihydro-1H-1,3-diazonine |
|---|---|
| PubChem CID | 90969650 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 9-methyl-2-pyrrolidin-2-yl-4,9-dihydro-1H-1,3-diazonine |
| SMILES | CC1C=CC=CC/N=C(/C2CCCN2)N1 |
| InChI | InChI=1S/C12H19N3/c1-10-6-3-2-4-8-14-12(15-10)11-7-5-9-13-11/h2-4,6,10-11,13H,5,7-9H2,1H3,(H,14,15) |
| InChIKey | UNRAAFXXIQCBRF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |