C13H21N3 — CID 143939515
N'-methyl-N-(3-methylcyclohexa-1,5-dien-1-yl)pyrrolidine-2-carboximidamide (PubChem CID 143939515) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is N'-methyl-N-(3-methylcyclohexa-1,5-dien-1-yl)pyrrolidine-2-carboximidamide.
| Compound Name | N'-methyl-N-(3-methylcyclohexa-1,5-dien-1-yl)pyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 143939515 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N'-methyl-N-(3-methylcyclohexa-1,5-dien-1-yl)pyrrolidine-2-carboximidamide |
| SMILES | C/N=C(/NC1=CC(C)CC=C1)C1CCCN1 |
| InChI | InChI=1S/C13H21N3/c1-10-5-3-6-11(9-10)16-13(14-2)12-7-4-8-15-12/h3,6,9-10,12,15H,4-5,7-8H2,1-2H3,(H,14,16) |
| InChIKey | QKHBEOYHGZGSJY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|