C15H25N4+ — CID 91197302
4-[1,1-dimethyl-2-(1-methylpyrrolidin-2-yl)imidazol-1-ium-4-yl]-1,2,3,6-tetrahydropyridine (PubChem CID 91197302) has the molecular formula C15H25N4+ and a molecular weight of 261.39 g/mol. Its IUPAC name is 4-[1,1-dimethyl-2-(1-methylpyrrolidin-2-yl)imidazol-1-ium-4-yl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-[1,1-dimethyl-2-(1-methylpyrrolidin-2-yl)imidazol-1-ium-4-yl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 91197302 |
| Molecular Formula | C15H25N4+ |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 4-[1,1-dimethyl-2-(1-methylpyrrolidin-2-yl)imidazol-1-ium-4-yl]-1,2,3,6-tetrahydropyridine |
| SMILES | CN1CCCC1C1=NC(C2=CCNCC2)=C[N+]1(C)C |
| InChI | InChI=1S/C15H25N4/c1-18-10-4-5-14(18)15-17-13(11-19(15,2)3)12-6-8-16-9-7-12/h6,11,14,16H,4-5,7-10H2,1-3H3/q+1 |
| InChIKey | QIGGOHHWWTZIAO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|