C12H20N2 — CID 143637445
butane;2-methyl-3a,7a-dihydro-1H-benzimidazole (PubChem CID 143637445) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is butane;2-methyl-3a,7a-dihydro-1H-benzimidazole.
| Compound Name | butane;2-methyl-3a,7a-dihydro-1H-benzimidazole |
|---|---|
| PubChem CID | 143637445 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | butane;2-methyl-3a,7a-dihydro-1H-benzimidazole |
| SMILES | CC1=NC2C=CC=CC2N1.CCCC |
| InChI | InChI=1S/C8H10N2.C4H10/c1-6-9-7-4-2-3-5-8(7)10-6;1-3-4-2/h2-5,7-8H,1H3,(H,9,10);3-4H2,1-2H3 |
| InChIKey | KXPMACRCSSFFIC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |