C8H9ClN2 — CID 58770067
2-(chloromethyl)-3a,7a-dihydro-1H-benzimidazole (PubChem CID 58770067) has the molecular formula C8H9ClN2 and a molecular weight of 168.63 g/mol. Its IUPAC name is 2-(chloromethyl)-3a,7a-dihydro-1H-benzimidazole.
| Compound Name | 2-(chloromethyl)-3a,7a-dihydro-1H-benzimidazole |
|---|---|
| PubChem CID | 58770067 |
| Molecular Formula | C8H9ClN2 |
| Molecular Weight | 168.63 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 2-(chloromethyl)-3a,7a-dihydro-1H-benzimidazole |
| SMILES | ClCC1=NC2C=CC=CC2N1 |
| InChI | InChI=1S/C8H9ClN2/c9-5-8-10-6-3-1-2-4-7(6)11-8/h1-4,6-7H,5H2,(H,10,11) |
| InChIKey | KRKWMIMZMIQPRN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.63 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|