C9H13N3 — CID 10511207
2-(3a,7a-dihydro-1H-benzimidazol-2-yl)ethanamine (PubChem CID 10511207) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-(3a,7a-dihydro-1H-benzimidazol-2-yl)ethanamine.
| Compound Name | 2-(3a,7a-dihydro-1H-benzimidazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 10511207 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 2-(3a,7a-dihydro-1H-benzimidazol-2-yl)ethanamine |
| SMILES | NCCC1=NC2C=CC=CC2N1 |
| InChI | InChI=1S/C9H13N3/c10-6-5-9-11-7-3-1-2-4-8(7)12-9/h1-4,7-8H,5-6,10H2,(H,11,12) |
| InChIKey | KNLCALUGXCAULQ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |