C23H36N2 — CID 123310112
(E)-N'-ethenyl-2-prop-1-enyl-N-[(E)-3,5,7-trimethyldec-4-en-4-yl]pent-2-en-4-ynimidamide (PubChem CID 123310112) has the molecular formula C23H36N2 and a molecular weight of 340.56 g/mol. Its IUPAC name is (E)-N'-ethenyl-2-prop-1-enyl-N-[(E)-3,5,7-trimethyldec-4-en-4-yl]pent-2-en-4-ynimidamide.
| Compound Name | (E)-N'-ethenyl-2-prop-1-enyl-N-[(E)-3,5,7-trimethyldec-4-en-4-yl]pent-2-en-4-ynimidamide |
|---|---|
| PubChem CID | 123310112 |
| Molecular Formula | C23H36N2 |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | (E)-N'-ethenyl-2-prop-1-enyl-N-[(E)-3,5,7-trimethyldec-4-en-4-yl]pent-2-en-4-ynimidamide |
| SMILES | C#C/C=C(C=CC)/C(=N\C=C)N/C(=C(\C)CC(C)CCC)C(C)CC |
| InChI | InChI=1S/C23H36N2/c1-9-14-18(6)17-20(8)22(19(7)12-4)25-23(24-13-5)21(15-10-2)16-11-3/h2,11,13,15-16,18-19H,5,9,12,14,17H2,1,3-4,6-8H3,(H,24,25)/b16-11?,21-15+,22-20+ |
| InChIKey | DTDZTXLJXIXCAH-RIHPRNGISA-N |
| XLogP | 6.40 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|