C27H36N2 — CID 177191968
N-[(3E)-2,6-dimethyl-5-methylidenehepta-1,3-dien-3-yl]-N'-[(1Z,4Z,6Z)-3-methylidene-4-prop-1-ynylocta-1,4,6-trienyl]prop-2-ynimidamide;ethane (PubChem CID 177191968) has the molecular formula C27H36N2 and a molecular weight of 388.60 g/mol. Its IUPAC name is N-[(3E)-2,6-dimethyl-5-methylidenehepta-1,3-dien-3-yl]-N'-[(1Z,4Z,6Z)-3-methylidene-4-prop-1-ynylocta-1,4,6-trienyl]prop-2-ynimidamide;ethane.
| Compound Name | N-[(3E)-2,6-dimethyl-5-methylidenehepta-1,3-dien-3-yl]-N'-[(1Z,4Z,6Z)-3-methylidene-4-prop-1-ynylocta-1,4,6-trienyl]prop-2-ynimidamide;ethane |
|---|---|
| PubChem CID | 177191968 |
| Molecular Formula | C27H36N2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | N-[(3E)-2,6-dimethyl-5-methylidenehepta-1,3-dien-3-yl]-N'-[(1Z,4Z,6Z)-3-methylidene-4-prop-1-ynylocta-1,4,6-trienyl]prop-2-ynimidamide;ethane |
| SMILES | C#C/C(=N\C=C/C(=C)/C(C#CC)=C/C=C\C)N/C(=C/C(=C)C(C)C)C(=C)C.CC |
| InChI | InChI=1S/C25H30N2.C2H6/c1-10-13-15-23(14-11-2)21(8)16-17-26-25(12-3)27-24(20(6)7)18-22(9)19(4)5;1-2/h3,10,13,15-19H,6,8-9H2,1-2,4-5,7H3,(H,26,27);1-2H3/b13-10-,17-16-,23-15+,24-18+; |
| InChIKey | VLJNJGWUUZVCSZ-ZJQIETDMSA-N |
| XLogP | 6.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|