C25H30N2 — CID 177191969
N-[(3E)-2,6-dimethyl-5-methylidenehepta-1,3-dien-3-yl]-N'-[(1Z,4Z,6Z)-3-methylidene-4-prop-1-ynylocta-1,4,6-trienyl]prop-2-ynimidamide (PubChem CID 177191969) has the molecular formula C25H30N2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N-[(3E)-2,6-dimethyl-5-methylidenehepta-1,3-dien-3-yl]-N'-[(1Z,4Z,6Z)-3-methylidene-4-prop-1-ynylocta-1,4,6-trienyl]prop-2-ynimidamide.
| Compound Name | N-[(3E)-2,6-dimethyl-5-methylidenehepta-1,3-dien-3-yl]-N'-[(1Z,4Z,6Z)-3-methylidene-4-prop-1-ynylocta-1,4,6-trienyl]prop-2-ynimidamide |
|---|---|
| PubChem CID | 177191969 |
| Molecular Formula | C25H30N2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N-[(3E)-2,6-dimethyl-5-methylidenehepta-1,3-dien-3-yl]-N'-[(1Z,4Z,6Z)-3-methylidene-4-prop-1-ynylocta-1,4,6-trienyl]prop-2-ynimidamide |
| SMILES | C#C/C(=N\C=C/C(=C)/C(C#CC)=C/C=C\C)N/C(=C/C(=C)C(C)C)C(=C)C |
| InChI | InChI=1S/C25H30N2/c1-10-13-15-23(14-11-2)21(8)16-17-26-25(12-3)27-24(20(6)7)18-22(9)19(4)5/h3,10,13,15-19H,6,8-9H2,1-2,4-5,7H3,(H,26,27)/b13-10-,17-16-,23-15+,24-18+ |
| InChIKey | PTUFDANXGHSCBC-DPWNQMRQSA-N |
| XLogP | 5.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|