C15H28N2 — CID 176939648
ethane;2-[[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]amino]acetonitrile;propane (PubChem CID 176939648) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is ethane;2-[[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]amino]acetonitrile;propane.
| Compound Name | ethane;2-[[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]amino]acetonitrile;propane |
|---|---|
| PubChem CID | 176939648 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | ethane;2-[[(3E,5Z)-2-methylhepta-1,3,5-trien-3-yl]amino]acetonitrile;propane |
| SMILES | C=C(C)/C(=C\C=C/C)NCC#N.CC.CCC |
| InChI | InChI=1S/C10H14N2.C3H8.C2H6/c1-4-5-6-10(9(2)3)12-8-7-11;1-3-2;1-2/h4-6,12H,2,8H2,1,3H3;3H2,1-2H3;1-2H3/b5-4-,10-6+;; |
| InChIKey | MVLZHJNFPLVEKR-PNWHQIDPSA-N |
| XLogP | 4.58 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|