C18H26N2O2S — CID 123998603
N'-hexa-2,4-dien-3-ylsulfonyl-2-methyl-N-(2-methylhepta-1,3,5-trien-3-yl)prop-2-enimidamide (PubChem CID 123998603) has the molecular formula C18H26N2O2S and a molecular weight of 334.49 g/mol. Its IUPAC name is N'-hexa-2,4-dien-3-ylsulfonyl-2-methyl-N-(2-methylhepta-1,3,5-trien-3-yl)prop-2-enimidamide.
| Compound Name | N'-hexa-2,4-dien-3-ylsulfonyl-2-methyl-N-(2-methylhepta-1,3,5-trien-3-yl)prop-2-enimidamide |
|---|---|
| PubChem CID | 123998603 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | N'-hexa-2,4-dien-3-ylsulfonyl-2-methyl-N-(2-methylhepta-1,3,5-trien-3-yl)prop-2-enimidamide |
| SMILES | C=C(C)C(=CC=CC)NC(=NS(=O)(=O)C(C=CC)=CC)C(=C)C |
| InChI | InChI=1S/C18H26N2O2S/c1-8-11-13-17(14(4)5)19-18(15(6)7)20-23(21,22)16(10-3)12-9-2/h8-13H,4,6H2,1-3,5,7H3,(H,19,20) |
| InChIKey | HMDITDVGNKZTOK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|