C33H51N3 — CID 144539707
(Z)-N-[4-[(3Z,5E,6Z)-4,10-diethyl-5-ethylidene-7-methyltrideca-3,6-dien-6-yl]-2,5-dimethylidenepyrrol-3-yl]-N'-[(Z)-prop-1-enyl]but-2-enimidamide (PubChem CID 144539707) has the molecular formula C33H51N3 and a molecular weight of 489.79 g/mol. Its IUPAC name is (Z)-N-[4-[(3Z,5E,6Z)-4,10-diethyl-5-ethylidene-7-methyltrideca-3,6-dien-6-yl]-2,5-dimethylidenepyrrol-3-yl]-N'-[(Z)-prop-1-enyl]but-2-enimidamide.
| Compound Name | (Z)-N-[4-[(3Z,5E,6Z)-4,10-diethyl-5-ethylidene-7-methyltrideca-3,6-dien-6-yl]-2,5-dimethylidenepyrrol-3-yl]-N'-[(Z)-prop-1-enyl]but-2-enimidamide |
|---|---|
| PubChem CID | 144539707 |
| Molecular Formula | C33H51N3 |
| Molecular Weight | 489.79 g/mol |
| Exact Mass | 489.41 |
| IUPAC Name | (Z)-N-[4-[(3Z,5E,6Z)-4,10-diethyl-5-ethylidene-7-methyltrideca-3,6-dien-6-yl]-2,5-dimethylidenepyrrol-3-yl]-N'-[(Z)-prop-1-enyl]but-2-enimidamide |
| SMILES | C=c1[nH]c(=C)c(C(=C(/C)CCC(CC)CCC)/C(=C/C)C(=C\CC)/CC)c1NC(/C=C\C)=N/C=C\C |
| InChI | InChI=1S/C33H51N3/c1-11-18-27(15-5)22-21-24(8)31(29(17-7)28(16-6)19-12-2)32-25(9)35-26(10)33(32)36-30(20-13-3)34-23-14-4/h13-14,17,19-20,23,27,35H,9-12,15-16,18,21-22H2,1-8H3,(H,34,36)/b20-13-,23-14-,28-19-,29-17+,31-24- |
| InChIKey | KXSWVSZDQOEGFW-SCHJWQBRSA-N |
| XLogP | 8.83 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.79 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|