C26H34N4 — CID 123807634
(1Z,3E,5E)-6-[6-cyclopentyl-4-(2-methyl-3a,4-dihydro-1H-benzimidazol-5-yl)cyclohexa-1,3-dien-1-yl]-3-methylhexa-1,3,5-triene-1,2-diamine (PubChem CID 123807634) has the molecular formula C26H34N4 and a molecular weight of 402.59 g/mol. Its IUPAC name is (1Z,3E,5E)-6-[6-cyclopentyl-4-(2-methyl-3a,4-dihydro-1H-benzimidazol-5-yl)cyclohexa-1,3-dien-1-yl]-3-methylhexa-1,3,5-triene-1,2-diamine.
| Compound Name | (1Z,3E,5E)-6-[6-cyclopentyl-4-(2-methyl-3a,4-dihydro-1H-benzimidazol-5-yl)cyclohexa-1,3-dien-1-yl]-3-methylhexa-1,3,5-triene-1,2-diamine |
|---|---|
| PubChem CID | 123807634 |
| Molecular Formula | C26H34N4 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | (1Z,3E,5E)-6-[6-cyclopentyl-4-(2-methyl-3a,4-dihydro-1H-benzimidazol-5-yl)cyclohexa-1,3-dien-1-yl]-3-methylhexa-1,3,5-triene-1,2-diamine |
| SMILES | CC1=NC2CC(C3=CC=C(/C=C/C=C(C)/C(N)=C/N)C(C4CCCC4)C3)=CC=C2N1 |
| InChI | InChI=1S/C26H34N4/c1-17(24(28)16-27)6-5-9-20-10-11-21(14-23(20)19-7-3-4-8-19)22-12-13-25-26(15-22)30-18(2)29-25/h5-6,9-13,16,19,23,26H,3-4,7-8,14-15,27-28H2,1-2H3,(H,29,30)/b9-5+,17-6+,24-16- |
| InChIKey | SEPSXXANVZDUKX-KDMIBWNASA-N |
| XLogP | 4.91 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|