C26H33N4- — CID 123807633
(1Z,3E,5E)-6-[6-cyclopentyl-4-(2-methyl-3a,4-dihydro-1H-benzimidazol-5-yl)cyclohexa-1,3-dien-1-yl]-3-methylhexa-1,3,5-triene-1,2-diamine (PubChem CID 123807633) has the molecular formula C26H33N4- and a molecular weight of 401.58 g/mol. Its IUPAC name is (1Z,3E,5E)-6-[6-cyclopentyl-4-(2-methyl-3a,4-dihydro-1H-benzimidazol-5-yl)cyclohexa-1,3-dien-1-yl]-3-methylhexa-1,3,5-triene-1,2-diamine.
| Compound Name | (1Z,3E,5E)-6-[6-cyclopentyl-4-(2-methyl-3a,4-dihydro-1H-benzimidazol-5-yl)cyclohexa-1,3-dien-1-yl]-3-methylhexa-1,3,5-triene-1,2-diamine |
|---|---|
| PubChem CID | 123807633 |
| Molecular Formula | C26H33N4- |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | (1Z,3E,5E)-6-[6-cyclopentyl-4-(2-methyl-3a,4-dihydro-1H-benzimidazol-5-yl)cyclohexa-1,3-dien-1-yl]-3-methylhexa-1,3,5-triene-1,2-diamine |
| SMILES | CC1=NC2CC(C3=CC=C(/C=C/C=C(C)/C(N)=C/N)C(C4C[CH-]CC4)C3)=CC=C2N1 |
| InChI | InChI=1S/C26H33N4/c1-17(24(28)16-27)6-5-9-20-10-11-21(14-23(20)19-7-3-4-8-19)22-12-13-25-26(15-22)30-18(2)29-25/h3,5-6,9-13,16,19,23,26H,4,7-8,14-15,27-28H2,1-2H3,(H,29,30)/q-1/b9-5+,17-6+,24-16- |
| InChIKey | XIRVJEQCGGWERH-KDMIBWNASA-N |
| XLogP | 4.73 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|