C24H34N6 — CID 154539773
7-[5-[[cyclohex-2-en-1-yl(ethyl)amino]methyl]-2,3,3a,4-tetrahydro-1H-indol-2-yl]-2-methyl-3a,4-dihydro-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 154539773) has the molecular formula C24H34N6 and a molecular weight of 406.58 g/mol. Its IUPAC name is 7-[5-[[cyclohex-2-en-1-yl(ethyl)amino]methyl]-2,3,3a,4-tetrahydro-1H-indol-2-yl]-2-methyl-3a,4-dihydro-1H-imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 7-[5-[[cyclohex-2-en-1-yl(ethyl)amino]methyl]-2,3,3a,4-tetrahydro-1H-indol-2-yl]-2-methyl-3a,4-dihydro-1H-imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 154539773 |
| Molecular Formula | C24H34N6 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | 7-[5-[[cyclohex-2-en-1-yl(ethyl)amino]methyl]-2,3,3a,4-tetrahydro-1H-indol-2-yl]-2-methyl-3a,4-dihydro-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | CCN(CC1=CC=C2NC(C3=C4NC(C)=NC4NC(N)=C3)CC2C1)C1C=CCCC1 |
| InChI | InChI=1S/C24H34N6/c1-3-30(18-7-5-4-6-8-18)14-16-9-10-20-17(11-16)12-21(28-20)19-13-22(25)29-24-23(19)26-15(2)27-24/h5,7,9-10,13,17-18,21,24,28-29H,3-4,6,8,11-12,14,25H2,1-2H3,(H,26,27) |
| InChIKey | RZWHSQXZUFXGSD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|