C24H30N4 — CID 163611883
7-[(E)-2-(3-ethenyl-3,4-dihydro-2H-pyrrol-4-yl)ethenyl]-2,3-dimethyl-3a,6,7,8,9,10,11,11c-octahydroimidazo[4,5-a]phenanthridine (PubChem CID 163611883) has the molecular formula C24H30N4 and a molecular weight of 374.53 g/mol. Its IUPAC name is 7-[(E)-2-(3-ethenyl-3,4-dihydro-2H-pyrrol-4-yl)ethenyl]-2,3-dimethyl-3a,6,7,8,9,10,11,11c-octahydroimidazo[4,5-a]phenanthridine.
| Compound Name | 7-[(E)-2-(3-ethenyl-3,4-dihydro-2H-pyrrol-4-yl)ethenyl]-2,3-dimethyl-3a,6,7,8,9,10,11,11c-octahydroimidazo[4,5-a]phenanthridine |
|---|---|
| PubChem CID | 163611883 |
| Molecular Formula | C24H30N4 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 7-[(E)-2-(3-ethenyl-3,4-dihydro-2H-pyrrol-4-yl)ethenyl]-2,3-dimethyl-3a,6,7,8,9,10,11,11c-octahydroimidazo[4,5-a]phenanthridine |
| SMILES | C=CC1CN=CC1/C=C/C1NC2=C(C3=C1CCCC3)C1N=C(C)N(C)C1C=C2 |
| InChI | InChI=1S/C24H30N4/c1-4-16-13-25-14-17(16)9-10-20-18-7-5-6-8-19(18)23-21(27-20)11-12-22-24(23)26-15(2)28(22)3/h4,9-12,14,16-17,20,22,24,27H,1,5-8,13H2,2-3H3/b10-9+ |
| InChIKey | FISQTLZGURVFCD-MDZDMXLPSA-N |
| XLogP | 3.81 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|