C23H33N5 — CID 177039812
(5Z)-5-[2-[4-(ethylamino)butan-2-yl]-4-piperidin-4-ylidene-1H-imidazol-5-ylidene]-2,3-dihydroinden-1-amine (PubChem CID 177039812) has the molecular formula C23H33N5 and a molecular weight of 379.55 g/mol. Its IUPAC name is (5Z)-5-[2-[4-(ethylamino)butan-2-yl]-4-piperidin-4-ylidene-1H-imidazol-5-ylidene]-2,3-dihydroinden-1-amine.
| Compound Name | (5Z)-5-[2-[4-(ethylamino)butan-2-yl]-4-piperidin-4-ylidene-1H-imidazol-5-ylidene]-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 177039812 |
| Molecular Formula | C23H33N5 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | (5Z)-5-[2-[4-(ethylamino)butan-2-yl]-4-piperidin-4-ylidene-1H-imidazol-5-ylidene]-2,3-dihydroinden-1-amine |
| SMILES | CCNCCC(C)c1nc(=C2CCNCC2)/c(=c2\ccc3c(c2)CCC=3N)[nH]1 |
| InChI | InChI=1S/C23H33N5/c1-3-25-11-8-15(2)23-27-21(16-9-12-26-13-10-16)22(28-23)18-4-6-19-17(14-18)5-7-20(19)24/h4,6,14-15,25-26H,3,5,7-13,24H2,1-2H3,(H,27,28)/b22-18- |
| InChIKey | NYMVEKZAKCLFJU-PYCFMQQDSA-N |
| XLogP | 1.35 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|