C29H56N4 — CID 163661423
(2R)-N-[4-[2-[(Z,2S,3S,6S)-3-ethyl-6,7-dimethyloct-4-en-2-yl]cyclopropyl]-2-(piperazin-1-ylmethylideneamino)butyl]-2-methylbutan-1-amine (PubChem CID 163661423) has the molecular formula C29H56N4 and a molecular weight of 460.80 g/mol. Its IUPAC name is (2R)-N-[4-[2-[(Z,2S,3S,6S)-3-ethyl-6,7-dimethyloct-4-en-2-yl]cyclopropyl]-2-(piperazin-1-ylmethylideneamino)butyl]-2-methylbutan-1-amine.
| Compound Name | (2R)-N-[4-[2-[(Z,2S,3S,6S)-3-ethyl-6,7-dimethyloct-4-en-2-yl]cyclopropyl]-2-(piperazin-1-ylmethylideneamino)butyl]-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 163661423 |
| Molecular Formula | C29H56N4 |
| Molecular Weight | 460.80 g/mol |
| Exact Mass | 460.45 |
| IUPAC Name | (2R)-N-[4-[2-[(Z,2S,3S,6S)-3-ethyl-6,7-dimethyloct-4-en-2-yl]cyclopropyl]-2-(piperazin-1-ylmethylideneamino)butyl]-2-methylbutan-1-amine |
| SMILES | CC[C@@H](C)CNCC(CCC1CC1[C@H](C)[C@H](/C=C\[C@@H](C)C(C)C)CC)/N=C/N1CCNCC1 |
| InChI | InChI=1S/C29H56N4/c1-8-23(5)19-31-20-28(32-21-33-16-14-30-15-17-33)13-12-27-18-29(27)25(7)26(9-2)11-10-24(6)22(3)4/h10-11,21-31H,8-9,12-20H2,1-7H3/b11-10-,32-21+/t23-,24-,25-,26+,27?,28?,29?/m1/s1 |
| InChIKey | IUSPWWMILUPYDW-UHGRNDAJSA-N |
| XLogP | 5.85 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.80 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|