About heptane;methane;N'-methyl-N-[(Z)-8-methylnon-2-en-3-yl]methanimidamide
heptane;methane;N'-methyl-N-[(Z)-8-methylnon-2-en-3-yl]methanimidamide (PubChem CID 143961640) has the molecular formula C20H44N2
and a molecular weight of 312.59 g/mol. Its IUPAC name is heptane;methane;N'-methyl-N-[(Z)-8-methylnon-2-en-3-yl]methanimidamide.
Molecular Properties
| Compound Name | heptane;methane;N'-methyl-N-[(Z)-8-methylnon-2-en-3-yl]methanimidamide |
| PubChem CID | 143961640 |
| Molecular Formula | C20H44N2 |
| Molecular Weight | 312.59 g/mol |
| Exact Mass | 312.35 |
| IUPAC Name | heptane;methane;N'-methyl-N-[(Z)-8-methylnon-2-en-3-yl]methanimidamide |
| SMILES | C.C/C=C(/CCCCC(C)C)N/C=N/C.CCCCCCC |
| InChI | InChI=1S/C12H24N2.C7H16.CH4/c1-5-12(14-10-13-4)9-7-6-8-11(2)3;1-3-5-7-6-4-2;/h5,10-11H,6-9H2,1-4H3,(H,13,14);3-7H2,1-2H3;1H4/b12-5-;; |
| InChIKey | ZWHFJVRXFJWIDR-KYWGTZADSA-N |
| XLogP | 6.97 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.59 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze heptane;methane;N'-methyl-N-[(Z)-8-methylnon-2-en-3-yl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane;methane;N'-methyl-N-[(Z)-8-methylnon-2-en-3-yl]methanimidamide?
The IUPAC name of heptane;methane;N'-methyl-N-[(Z)-8-methylnon-2-en-3-yl]methanimidamide (CID 143961640) is heptane;methane;N'-methyl-N-[(Z)-8-methylnon-2-en-3-yl]methanimidamide.
What is the SMILES notation for heptane;methane;N'-methyl-N-[(Z)-8-methylnon-2-en-3-yl]methanimidamide?
The canonical SMILES for heptane;methane;N'-methyl-N-[(Z)-8-methylnon-2-en-3-yl]methanimidamide is C.C/C=C(/CCCCC(C)C)N/C=N/C.CCCCCCC.
What is the InChIKey of heptane;methane;N'-methyl-N-[(Z)-8-methylnon-2-en-3-yl]methanimidamide?
The InChIKey is ZWHFJVRXFJWIDR-KYWGTZADSA-N. The full InChI is InChI=1S/C12H24N2.C7H16.CH4/c1-5-12(14-10-13-4)9-7-6-8-11(2)3;1-3-5-7-6-4-2;/h5,10-11H,6-9H2,1-4H3,(H,13,14);3-7H2,1-2H3;1H4/b12-5-;;.
What are the key properties of heptane;methane;N'-methyl-N-[(Z)-8-methylnon-2-en-3-yl]methanimidamide?
heptane;methane;N'-methyl-N-[(Z)-8-methylnon-2-en-3-yl]methanimidamide has a molecular weight of 312.59 g/mol, XLogP of 6.97, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for heptane;methane;N'-methyl-N-[(Z)-8-methylnon-2-en-3-yl]methanimidamide is sourced from PubChem (CID 143961640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).