C20H36N2 — CID 123598624
5-methyl-7-(9-methyl-4-methylidenedodec-10-enyl)-4,5,6,7-tetrahydro-1H-1,3-diazepine (PubChem CID 123598624) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is 5-methyl-7-(9-methyl-4-methylidenedodec-10-enyl)-4,5,6,7-tetrahydro-1H-1,3-diazepine.
| Compound Name | 5-methyl-7-(9-methyl-4-methylidenedodec-10-enyl)-4,5,6,7-tetrahydro-1H-1,3-diazepine |
|---|---|
| PubChem CID | 123598624 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 5-methyl-7-(9-methyl-4-methylidenedodec-10-enyl)-4,5,6,7-tetrahydro-1H-1,3-diazepine |
| SMILES | C=C(CCCCC(C)C=CC)CCCC1CC(C)CN=CN1 |
| InChI | InChI=1S/C20H36N2/c1-5-9-17(2)10-6-7-11-18(3)12-8-13-20-14-19(4)15-21-16-22-20/h5,9,16-17,19-20H,3,6-8,10-15H2,1-2,4H3,(H,21,22) |
| InChIKey | OEMWZMZDBKQXFJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|