C19H37N3 — CID 11727625
1-[2-(cyclohexen-1-yl)ethyl]-2-(3,7-dimethyloctyl)guanidine (PubChem CID 11727625) has the molecular formula C19H37N3 and a molecular weight of 307.53 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-2-(3,7-dimethyloctyl)guanidine.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-(3,7-dimethyloctyl)guanidine |
|---|---|
| PubChem CID | 11727625 |
| Molecular Formula | C19H37N3 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.30 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-(3,7-dimethyloctyl)guanidine |
| SMILES | CC(C)CCCC(C)CC/N=C(\N)NCCC1=CCCCC1 |
| InChI | InChI=1S/C19H37N3/c1-16(2)8-7-9-17(3)12-14-21-19(20)22-15-13-18-10-5-4-6-11-18/h10,16-17H,4-9,11-15H2,1-3H3,(H3,20,21,22) |
| InChIKey | SBJWHIUMPGZRIL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|