C19H27FN2 — CID 90781512
N-cyclohexyl-1-(5-fluoro-2-methylidene-1-pyridinyl)-2-propan-2-ylbut-2-en-1-imine (PubChem CID 90781512) has the molecular formula C19H27FN2 and a molecular weight of 302.44 g/mol. Its IUPAC name is N-cyclohexyl-1-(5-fluoro-2-methylidene-1-pyridinyl)-2-propan-2-ylbut-2-en-1-imine.
| Compound Name | N-cyclohexyl-1-(5-fluoro-2-methylidene-1-pyridinyl)-2-propan-2-ylbut-2-en-1-imine |
|---|---|
| PubChem CID | 90781512 |
| Molecular Formula | C19H27FN2 |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | N-cyclohexyl-1-(5-fluoro-2-methylidene-1-pyridinyl)-2-propan-2-ylbut-2-en-1-imine |
| SMILES | C=C1C=CC(F)=CN1/C(=N/C1CCCCC1)C(=CC)C(C)C |
| InChI | InChI=1S/C19H27FN2/c1-5-18(14(2)3)19(21-17-9-7-6-8-10-17)22-13-16(20)12-11-15(22)4/h5,11-14,17H,4,6-10H2,1-3H3/b18-5?,21-19+ |
| InChIKey | KAMWGILJBYKTJH-YYPPYOSESA-N |
| XLogP | 5.52 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|