C24H41N3 — CID 118617834
(2E,4E)-6-methyl-5-[C-(4-methylpiperidin-1-yl)-N-prop-1-en-2-ylcarbonimidoyl]-N,N-dipropylhepta-2,4,6-trien-3-amine (PubChem CID 118617834) has the molecular formula C24H41N3 and a molecular weight of 371.61 g/mol. Its IUPAC name is (2E,4E)-6-methyl-5-[C-(4-methylpiperidin-1-yl)-N-prop-1-en-2-ylcarbonimidoyl]-N,N-dipropylhepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4E)-6-methyl-5-[C-(4-methylpiperidin-1-yl)-N-prop-1-en-2-ylcarbonimidoyl]-N,N-dipropylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 118617834 |
| Molecular Formula | C24H41N3 |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.33 |
| IUPAC Name | (2E,4E)-6-methyl-5-[C-(4-methylpiperidin-1-yl)-N-prop-1-en-2-ylcarbonimidoyl]-N,N-dipropylhepta-2,4,6-trien-3-amine |
| SMILES | C=C(C)/N=C(C(=C/C(=C\C)N(CCC)CCC)/C(=C)C)\N1CCC(C)CC1 |
| InChI | InChI=1S/C24H41N3/c1-9-14-26(15-10-2)22(11-3)18-23(19(4)5)24(25-20(6)7)27-16-12-21(8)13-17-27/h11,18,21H,4,6,9-10,12-17H2,1-3,5,7-8H3/b22-11+,23-18+,25-24- |
| InChIKey | LKZIAURWFNRLMZ-DROHGTBOSA-N |
| XLogP | 6.18 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|