C28H31N5 — CID 91546958
10-cyclohepta-1,3,5,6-tetraen-1-yl-2-[[4-(5-methyl-4,5-dihydro-2H-pyrimidin-3-yl)cyclohepta-1,3,5-trien-1-yl]methyl]-4,6,9,10-tetrahydro-[1,3,5]triazino[1,2-a]azepine (PubChem CID 91546958) has the molecular formula C28H31N5 and a molecular weight of 437.59 g/mol. Its IUPAC name is 10-cyclohepta-1,3,5,6-tetraen-1-yl-2-[[4-(5-methyl-4,5-dihydro-2H-pyrimidin-3-yl)cyclohepta-1,3,5-trien-1-yl]methyl]-4,6,9,10-tetrahydro-[1,3,5]triazino[1,2-a]azepine.
| Compound Name | 10-cyclohepta-1,3,5,6-tetraen-1-yl-2-[[4-(5-methyl-4,5-dihydro-2H-pyrimidin-3-yl)cyclohepta-1,3,5-trien-1-yl]methyl]-4,6,9,10-tetrahydro-[1,3,5]triazino[1,2-a]azepine |
|---|---|
| PubChem CID | 91546958 |
| Molecular Formula | C28H31N5 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 10-cyclohepta-1,3,5,6-tetraen-1-yl-2-[[4-(5-methyl-4,5-dihydro-2H-pyrimidin-3-yl)cyclohepta-1,3,5-trien-1-yl]methyl]-4,6,9,10-tetrahydro-[1,3,5]triazino[1,2-a]azepine |
| SMILES | CC1C=NCN(C2=CC=C(CC3=NCN4CC=CCC(C5=CC=CC=C=C5)C4=N3)CC=C2)C1 |
| InChI | InChI=1S/C28H31N5/c1-22-18-29-20-33(19-22)25-12-8-9-23(14-15-25)17-27-30-21-32-16-7-6-13-26(28(32)31-27)24-10-4-2-3-5-11-24/h2-4,6-8,10-12,14-15,18,22,26H,9,13,16-17,19-21H2,1H3 |
| InChIKey | CSASKOQLQPPBHQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 43.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|