C18H28N2 — CID 142388191
(3Z)-3-ethylidene-N-[(Z)-6-ethylnon-2-en-3-yl]pyridin-2-imine (PubChem CID 142388191) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is (3Z)-3-ethylidene-N-[(Z)-6-ethylnon-2-en-3-yl]pyridin-2-imine.
| Compound Name | (3Z)-3-ethylidene-N-[(Z)-6-ethylnon-2-en-3-yl]pyridin-2-imine |
|---|---|
| PubChem CID | 142388191 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | (3Z)-3-ethylidene-N-[(Z)-6-ethylnon-2-en-3-yl]pyridin-2-imine |
| SMILES | C/C=C(CCC(CC)CCC)\N=C1/N=CC=C/C1=C/C |
| InChI | InChI=1S/C18H28N2/c1-5-10-15(6-2)12-13-17(8-4)20-18-16(7-3)11-9-14-19-18/h7-9,11,14-15H,5-6,10,12-13H2,1-4H3/b16-7-,17-8-,20-18- |
| InChIKey | IEDBPASRJUFGBN-XKWOWMKVSA-N |
| XLogP | 5.48 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|