C24H26N4 — CID 91459294
N'-(4-cyclohexa-1,5-dien-1-yl-2,3-dihydropyridin-6-yl)-N-(4-cyclohexa-2,4-dien-1-yl-3,4-dihydropyridin-6-yl)ethane-1,2-diimine (PubChem CID 91459294) has the molecular formula C24H26N4 and a molecular weight of 370.50 g/mol. Its IUPAC name is N'-(4-cyclohexa-1,5-dien-1-yl-2,3-dihydropyridin-6-yl)-N-(4-cyclohexa-2,4-dien-1-yl-3,4-dihydropyridin-6-yl)ethane-1,2-diimine.
| Compound Name | N'-(4-cyclohexa-1,5-dien-1-yl-2,3-dihydropyridin-6-yl)-N-(4-cyclohexa-2,4-dien-1-yl-3,4-dihydropyridin-6-yl)ethane-1,2-diimine |
|---|---|
| PubChem CID | 91459294 |
| Molecular Formula | C24H26N4 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | N'-(4-cyclohexa-1,5-dien-1-yl-2,3-dihydropyridin-6-yl)-N-(4-cyclohexa-2,4-dien-1-yl-3,4-dihydropyridin-6-yl)ethane-1,2-diimine |
| SMILES | C1=CCC(C2C=C(N=C/C=N/C3=NCCC(C4=CCCC=C4)=C3)N=CC2)C=C1 |
| InChI | InChI=1S/C24H26N4/c1-3-7-19(8-4-1)21-11-13-25-23(17-21)27-15-16-28-24-18-22(12-14-26-24)20-9-5-2-6-10-20/h1,3-5,7,9-10,13,15-19,21H,2,6,8,11-12,14H2/b27-15?,28-16+ |
| InChIKey | CKYFWVBEMXGECM-VAHHGSKZSA-N |
| XLogP | 5.20 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|