C22H24N2 — CID 166864724
N'-[(E)-2-cyclohexa-1,3-dien-1-ylethenyl]-N-(cyclohexa-1,5-dien-1-ylmethylidene)cyclohexa-2,4-diene-1-carboximidamide (PubChem CID 166864724) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is N'-[(E)-2-cyclohexa-1,3-dien-1-ylethenyl]-N-(cyclohexa-1,5-dien-1-ylmethylidene)cyclohexa-2,4-diene-1-carboximidamide.
| Compound Name | N'-[(E)-2-cyclohexa-1,3-dien-1-ylethenyl]-N-(cyclohexa-1,5-dien-1-ylmethylidene)cyclohexa-2,4-diene-1-carboximidamide |
|---|---|
| PubChem CID | 166864724 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N'-[(E)-2-cyclohexa-1,3-dien-1-ylethenyl]-N-(cyclohexa-1,5-dien-1-ylmethylidene)cyclohexa-2,4-diene-1-carboximidamide |
| SMILES | C1=CCCC(/C=C/N=C(\N=C\C2=CCCC=C2)C2C=CC=CC2)=C1 |
| InChI | InChI=1S/C22H24N2/c1-4-10-19(11-5-1)16-17-23-22(21-14-8-3-9-15-21)24-18-20-12-6-2-7-13-20/h1,3-4,6,8-10,12-14,16-18,21H,2,5,7,11,15H2/b17-16+,23-22-,24-18+ |
| InChIKey | SGJGTIYFZHTCPN-UJTLKKTDSA-N |
| XLogP | 5.65 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|