C14H20N2 — CID 144535800
(2E)-2-but-1-en-2-yl-N-ethylidene-N'-prop-1-en-2-ylpenta-2,4-dienimidamide (PubChem CID 144535800) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (2E)-2-but-1-en-2-yl-N-ethylidene-N'-prop-1-en-2-ylpenta-2,4-dienimidamide.
| Compound Name | (2E)-2-but-1-en-2-yl-N-ethylidene-N'-prop-1-en-2-ylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 144535800 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (2E)-2-but-1-en-2-yl-N-ethylidene-N'-prop-1-en-2-ylpenta-2,4-dienimidamide |
| SMILES | C=C/C=C(C(=C)CC)/C(/N=C/C)=N\C(=C)C |
| InChI | InChI=1S/C14H20N2/c1-7-10-13(12(6)8-2)14(15-9-3)16-11(4)5/h7,9-10H,1,4,6,8H2,2-3,5H3/b13-10+,15-9+,16-14- |
| InChIKey | IZRCZJQTPYFIRX-RFMWVACDSA-N |
| XLogP | 4.09 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|