C14H19FN2 — CID 144934445
(2E,4Z)-2-(3-fluorobut-1-en-2-yl)-N'-methyl-N-prop-2-enylidenehexa-2,4-dienimidamide (PubChem CID 144934445) has the molecular formula C14H19FN2 and a molecular weight of 234.32 g/mol. Its IUPAC name is (2E,4Z)-2-(3-fluorobut-1-en-2-yl)-N'-methyl-N-prop-2-enylidenehexa-2,4-dienimidamide.
| Compound Name | (2E,4Z)-2-(3-fluorobut-1-en-2-yl)-N'-methyl-N-prop-2-enylidenehexa-2,4-dienimidamide |
|---|---|
| PubChem CID | 144934445 |
| Molecular Formula | C14H19FN2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (2E,4Z)-2-(3-fluorobut-1-en-2-yl)-N'-methyl-N-prop-2-enylidenehexa-2,4-dienimidamide |
| SMILES | C=C/C=N/C(=N\C)/C(=C\C=C/C)C(=C)C(C)F |
| InChI | InChI=1S/C14H19FN2/c1-6-8-9-13(11(3)12(4)15)14(16-5)17-10-7-2/h6-10,12H,2-3H2,1,4-5H3/b8-6-,13-9+,16-14-,17-10+ |
| InChIKey | FWIMDRVKALSSJB-FDDSQGSBSA-N |
| XLogP | 3.69 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|