C18H23N2P — CID 126516035
[(2E,8E,10E)-8-methyl-7-methylidene-10-(2-methyl-4-methylidenepyrimidin-5-ylidene)deca-2,4,8-trien-3-yl]phosphane (PubChem CID 126516035) has the molecular formula C18H23N2P and a molecular weight of 298.37 g/mol. Its IUPAC name is [(2E,8E,10E)-8-methyl-7-methylidene-10-(2-methyl-4-methylidenepyrimidin-5-ylidene)deca-2,4,8-trien-3-yl]phosphane.
| Compound Name | [(2E,8E,10E)-8-methyl-7-methylidene-10-(2-methyl-4-methylidenepyrimidin-5-ylidene)deca-2,4,8-trien-3-yl]phosphane |
|---|---|
| PubChem CID | 126516035 |
| Molecular Formula | C18H23N2P |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | [(2E,8E,10E)-8-methyl-7-methylidene-10-(2-methyl-4-methylidenepyrimidin-5-ylidene)deca-2,4,8-trien-3-yl]phosphane |
| SMILES | C=C(CC=C/C(P)=C\C)/C(C)=C/C=c1/cnc(C)nc1=C |
| InChI | InChI=1S/C18H23N2P/c1-6-18(21)9-7-8-13(2)14(3)10-11-17-12-19-16(5)20-15(17)4/h6-7,9-12H,2,4,8,21H2,1,3,5H3/b9-7?,14-10+,17-11-,18-6+ |
| InChIKey | GHLPGKKLFMNRDO-IAKLGYOISA-N |
| XLogP | 3.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|