C15H24N2 — CID 142280939
ethane;(4E,5E)-2-methyl-4,5-bis(prop-2-enylidene)pyrimidine (PubChem CID 142280939) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is ethane;(4E,5E)-2-methyl-4,5-bis(prop-2-enylidene)pyrimidine.
| Compound Name | ethane;(4E,5E)-2-methyl-4,5-bis(prop-2-enylidene)pyrimidine |
|---|---|
| PubChem CID | 142280939 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | ethane;(4E,5E)-2-methyl-4,5-bis(prop-2-enylidene)pyrimidine |
| SMILES | C=C/C=c1/cnc(C)n/c1=C/C=C.CC.CC |
| InChI | InChI=1S/C11H12N2.2C2H6/c1-4-6-10-8-12-9(3)13-11(10)7-5-2;2*1-2/h4-8H,1-2H2,3H3;2*1-2H3/b10-6-,11-7+;; |
| InChIKey | IUPPVHBVPWYIAT-ZKEATHAOSA-N |
| XLogP | 2.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |