C14H18N3Pm3-3 — CID 59491923
carbanide;7,8-dihydropyrido[2,3-b][1,8]naphthyridine;promethium (PubChem CID 59491923) has the molecular formula C14H18N3Pm3-3 and a molecular weight of 663.32 g/mol. Its IUPAC name is carbanide;7,8-dihydropyrido[2,3-b][1,8]naphthyridine;promethium.
| Compound Name | carbanide;7,8-dihydropyrido[2,3-b][1,8]naphthyridine;promethium |
|---|---|
| PubChem CID | 59491923 |
| Molecular Formula | C14H18N3Pm3-3 |
| Molecular Weight | 663.32 g/mol |
| Exact Mass | 662.89 |
| IUPAC Name | carbanide;7,8-dihydropyrido[2,3-b][1,8]naphthyridine;promethium |
| SMILES | C1=c2cc3cccnc3nc2=NCC1.[CH3-].[CH3-].[CH3-].[Pm].[Pm].[Pm] |
| InChI | InChI=1S/C11H9N3.3CH3.3Pm/c1-3-8-7-9-4-2-6-13-11(9)14-10(8)12-5-1;;;;;;/h1,3-5,7H,2,6H2;3*1H3;;;/q;3*-1;;; |
| InChIKey | SBQTZFIQODXXQA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|