C10H8N2 — CID 91183051
2,3-dimethylidene-1,8-naphthyridine (PubChem CID 91183051) has the molecular formula C10H8N2 and a molecular weight of 156.19 g/mol. Its IUPAC name is 2,3-dimethylidene-1,8-naphthyridine.
| Compound Name | 2,3-dimethylidene-1,8-naphthyridine |
|---|---|
| PubChem CID | 91183051 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 2,3-dimethylidene-1,8-naphthyridine |
| SMILES | C=c1cc2cccnc2nc1=C |
| InChI | InChI=1S/C10H8N2/c1-7-6-9-4-3-5-11-10(9)12-8(7)2/h3-6H,1-2H2 |
| InChIKey | MLJMXICMFKKACN-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |