C12H10N2 — CID 57137694
3H-pyrido[2,1-b]quinazoline (PubChem CID 57137694) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is 3H-pyrido[2,1-b]quinazoline.
| Compound Name | 3H-pyrido[2,1-b]quinazoline |
|---|---|
| PubChem CID | 57137694 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 3H-pyrido[2,1-b]quinazoline |
| SMILES | C1=CC2=NC3=CCC=CC3=CN2C=C1 |
| InChI | InChI=1S/C12H10N2/c1-2-6-11-10(5-1)9-14-8-4-3-7-12(14)13-11/h1,3-9H,2H2 |
| InChIKey | VTRMXTGCYVSEGR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |