C8H12N2 — CID 23387651
N,1,4-trimethylpyridin-2-imine (PubChem CID 23387651) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is N,1,4-trimethylpyridin-2-imine.
| Compound Name | N,1,4-trimethylpyridin-2-imine |
|---|---|
| PubChem CID | 23387651 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | N,1,4-trimethylpyridin-2-imine |
| SMILES | C/N=c1\cc(C)ccn1C |
| InChI | InChI=1S/C8H12N2/c1-7-4-5-10(3)8(6-7)9-2/h4-6H,1-3H3/b9-8+ |
| InChIKey | KWHODFDXKFXEBK-CMDGGOBGSA-N |
| XLogP | 0.86 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |